C22H33FN2O4 — CID 122586241
methyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-2-fluoro-5-nitrophenyl]pentanoate (PubChem CID 122586241) has the molecular formula C22H33FN2O4 and a molecular weight of 408.51 g/mol. Its IUPAC name is methyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-2-fluoro-5-nitrophenyl]pentanoate.
| Compound Name | methyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-2-fluoro-5-nitrophenyl]pentanoate |
|---|---|
| PubChem CID | 122586241 |
| Molecular Formula | C22H33FN2O4 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | methyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-2-fluoro-5-nitrophenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1cc([N+](=O)[O-])c(N(CC(C)C)C2CCCCC2)cc1F |
| InChI | InChI=1S/C22H33FN2O4/c1-5-16(11-22(26)29-4)18-12-21(25(27)28)20(13-19(18)23)24(14-15(2)3)17-9-7-6-8-10-17/h12-13,15-17H,5-11,14H2,1-4H3 |
| InChIKey | CRLZUCBKAKTSSS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|