C19H29FN2O4 — CID 122586086
methyl 3-[5-amino-4-[ethyl(oxan-4-yl)amino]-2-fluorophenyl]-4-methoxybutanoate (PubChem CID 122586086) has the molecular formula C19H29FN2O4 and a molecular weight of 368.45 g/mol. Its IUPAC name is methyl 3-[5-amino-4-[ethyl(oxan-4-yl)amino]-2-fluorophenyl]-4-methoxybutanoate.
| Compound Name | methyl 3-[5-amino-4-[ethyl(oxan-4-yl)amino]-2-fluorophenyl]-4-methoxybutanoate |
|---|---|
| PubChem CID | 122586086 |
| Molecular Formula | C19H29FN2O4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 3-[5-amino-4-[ethyl(oxan-4-yl)amino]-2-fluorophenyl]-4-methoxybutanoate |
| SMILES | CCN(c1cc(F)c(C(COC)CC(=O)OC)cc1N)C1CCOCC1 |
| InChI | InChI=1S/C19H29FN2O4/c1-4-22(14-5-7-26-8-6-14)18-11-16(20)15(10-17(18)21)13(12-24-2)9-19(23)25-3/h10-11,13-14H,4-9,12,21H2,1-3H3 |
| InChIKey | ARFHWWHQFZATBO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|