C17H23F3N2O3 — CID 122587345
(3S)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4,4,4-trifluorobutanoic acid (PubChem CID 122587345) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is (3S)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4,4,4-trifluorobutanoic acid.
| Compound Name | (3S)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 122587345 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (3S)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4,4,4-trifluorobutanoic acid |
| SMILES | CCN(c1ccc([C@H](CC(=O)O)C(F)(F)F)cc1N)C1CCOCC1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-2-22(12-5-7-25-8-6-12)15-4-3-11(9-14(15)21)13(10-16(23)24)17(18,19)20/h3-4,9,12-13H,2,5-8,10,21H2,1H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | CYEJWPHENYXWOW-ZDUSSCGKSA-N |
| XLogP | 3.39 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|