(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid

C10H9ClF3NO2 — CID 90150629

IUPAC(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid
SMILESNc1cc([C@H](CC(=O)O)C(F)(F)F)ccc1Cl
InChIInChI=1S/C10H9ClF3NO2/c11-7-2-1-5(3-8(7)15)6(4-9(16)17)10(12,13)14/h1-3,6H,4,15H2,(H,16,17)/t6-/m0/s1
InChIKeyVKYYTBJOHKBQGB-LURJTMIESA-N
MW267.63 g/mol
LogP3.04
Rot. Bonds3

About (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid

(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid (PubChem CID 90150629) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid.

Molecular Properties

Compound Name(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid
PubChem CID90150629
Molecular FormulaC10H9ClF3NO2
Molecular Weight267.63 g/mol
Exact Mass267.03
IUPAC Name(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid
SMILESNc1cc([C@H](CC(=O)O)C(F)(F)F)ccc1Cl
InChIInChI=1S/C10H9ClF3NO2/c11-7-2-1-5(3-8(7)15)6(4-9(16)17)10(12,13)14/h1-3,6H,4,15H2,(H,16,17)/t6-/m0/s1
InChIKeyVKYYTBJOHKBQGB-LURJTMIESA-N
XLogP3.04
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.63
LogP ≤ 53.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid?
The IUPAC name of (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid (CID 90150629) is (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid?
The canonical SMILES for (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid is Nc1cc([C@H](CC(=O)O)C(F)(F)F)ccc1Cl.
What is the InChIKey of (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid?
The InChIKey is VKYYTBJOHKBQGB-LURJTMIESA-N. The full InChI is InChI=1S/C10H9ClF3NO2/c11-7-2-1-5(3-8(7)15)6(4-9(16)17)10(12,13)14/h1-3,6H,4,15H2,(H,16,17)/t6-/m0/s1.
What are the key properties of (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid?
(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid has a molecular weight of 267.63 g/mol, XLogP of 3.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 90150629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).