C10H9ClF3NO2 — CID 90150629
(3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid (PubChem CID 90150629) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid.
| Compound Name | (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 90150629 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (3S)-3-(3-amino-4-chlorophenyl)-4,4,4-trifluorobutanoic acid |
| SMILES | Nc1cc([C@H](CC(=O)O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H9ClF3NO2/c11-7-2-1-5(3-8(7)15)6(4-9(16)17)10(12,13)14/h1-3,6H,4,15H2,(H,16,17)/t6-/m0/s1 |
| InChIKey | VKYYTBJOHKBQGB-LURJTMIESA-N |
| XLogP | 3.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|