C11H14ClNO2 — CID 67215699
3-(3-amino-4-chlorophenyl)pentanoic acid (PubChem CID 67215699) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-(3-amino-4-chlorophenyl)pentanoic acid.
| Compound Name | 3-(3-amino-4-chlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 67215699 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-(3-amino-4-chlorophenyl)pentanoic acid |
| SMILES | CCC(CC(=O)O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C11H14ClNO2/c1-2-7(6-11(14)15)8-3-4-9(12)10(13)5-8/h3-5,7H,2,6,13H2,1H3,(H,14,15) |
| InChIKey | YPDNUSUDJMUAPR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|