C12H15Cl2NO2 — CID 142599841
(3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;hydrochloride (PubChem CID 142599841) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;hydrochloride.
| Compound Name | (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 142599841 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;hydrochloride |
| SMILES | Cl.Nc1cc([C@@H](CC(=O)O)C2CC2)ccc1Cl |
| InChI | InChI=1S/C12H14ClNO2.ClH/c13-10-4-3-8(5-11(10)14)9(6-12(15)16)7-1-2-7;/h3-5,7,9H,1-2,6,14H2,(H,15,16);1H/t9-;/m0./s1 |
| InChIKey | QFLLKEUIPLODPQ-FVGYRXGTSA-N |
| XLogP | 3.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|