C21H24ClNO3 — CID 175724922
(3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;2,3-dihydro-1H-inden-1-ol (PubChem CID 175724922) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;2,3-dihydro-1H-inden-1-ol.
| Compound Name | (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 175724922 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3S)-3-(3-amino-4-chlorophenyl)-3-cyclopropylpropanoic acid;2,3-dihydro-1H-inden-1-ol |
| SMILES | Nc1cc([C@@H](CC(=O)O)C2CC2)ccc1Cl.OC1CCc2ccccc21 |
| InChI | InChI=1S/C12H14ClNO2.C9H10O/c13-10-4-3-8(5-11(10)14)9(6-12(15)16)7-1-2-7;10-9-6-5-7-3-1-2-4-8(7)9/h3-5,7,9H,1-2,6,14H2,(H,15,16);1-4,9-10H,5-6H2/t9-;/m0./s1 |
| InChIKey | LALBPBSBBRATCM-FVGYRXGTSA-N |
| XLogP | 4.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|