C18H17FO2 — CID 117457802
3-cyclopropyl-3-(4-fluoro-3-phenylphenyl)propanoic acid (PubChem CID 117457802) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-cyclopropyl-3-(4-fluoro-3-phenylphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(4-fluoro-3-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117457802 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-cyclopropyl-3-(4-fluoro-3-phenylphenyl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc(F)c(-c2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C18H17FO2/c19-17-9-8-14(15(11-18(20)21)13-6-7-13)10-16(17)12-4-2-1-3-5-12/h1-5,8-10,13,15H,6-7,11H2,(H,20,21) |
| InChIKey | MFQWPZNUKPPDPV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |