C26H23FO5 — CID 164822877
(3S)-3-cyclopropyl-3-[3-[4-(2-fluoro-5-methoxyphenyl)phenoxy]carbonylphenyl]propanoic acid (PubChem CID 164822877) has the molecular formula C26H23FO5 and a molecular weight of 434.46 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[3-[4-(2-fluoro-5-methoxyphenyl)phenoxy]carbonylphenyl]propanoic acid.
| Compound Name | (3S)-3-cyclopropyl-3-[3-[4-(2-fluoro-5-methoxyphenyl)phenoxy]carbonylphenyl]propanoic acid |
|---|---|
| PubChem CID | 164822877 |
| Molecular Formula | C26H23FO5 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[3-[4-(2-fluoro-5-methoxyphenyl)phenoxy]carbonylphenyl]propanoic acid |
| SMILES | COc1ccc(F)c(-c2ccc(OC(=O)c3cccc([C@@H](CC(=O)O)C4CC4)c3)cc2)c1 |
| InChI | InChI=1S/C26H23FO5/c1-31-21-11-12-24(27)23(14-21)17-7-9-20(10-8-17)32-26(30)19-4-2-3-18(13-19)22(15-25(28)29)16-5-6-16/h2-4,7-14,16,22H,5-6,15H2,1H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | HPUJJTIIJHXMOM-QFIPXVFZSA-N |
| XLogP | 5.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|