C23H19FO6 — CID 155348037
(3R)-3-[3-[4-(2-fluoro-5-methoxyphenyl)benzoyl]oxyphenyl]-3-hydroxypropanoic acid (PubChem CID 155348037) has the molecular formula C23H19FO6 and a molecular weight of 410.40 g/mol. Its IUPAC name is (3R)-3-[3-[4-(2-fluoro-5-methoxyphenyl)benzoyl]oxyphenyl]-3-hydroxypropanoic acid.
| Compound Name | (3R)-3-[3-[4-(2-fluoro-5-methoxyphenyl)benzoyl]oxyphenyl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 155348037 |
| Molecular Formula | C23H19FO6 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (3R)-3-[3-[4-(2-fluoro-5-methoxyphenyl)benzoyl]oxyphenyl]-3-hydroxypropanoic acid |
| SMILES | COc1ccc(F)c(-c2ccc(C(=O)Oc3cccc([C@H](O)CC(=O)O)c3)cc2)c1 |
| InChI | InChI=1S/C23H19FO6/c1-29-17-9-10-20(24)19(12-17)14-5-7-15(8-6-14)23(28)30-18-4-2-3-16(11-18)21(25)13-22(26)27/h2-12,21,25H,13H2,1H3,(H,26,27)/t21-/m1/s1 |
| InChIKey | YDJHCXCIDZODBO-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|