C23H20FNO6 — CID 155342070
(3S)-3-cyclopropyl-3-[3-[3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-4-carbonyl]oxyphenyl]propanoic acid (PubChem CID 155342070) has the molecular formula C23H20FNO6 and a molecular weight of 425.41 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-[3-[3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-4-carbonyl]oxyphenyl]propanoic acid.
| Compound Name | (3S)-3-cyclopropyl-3-[3-[3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-4-carbonyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 155342070 |
| Molecular Formula | C23H20FNO6 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (3S)-3-cyclopropyl-3-[3-[3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-4-carbonyl]oxyphenyl]propanoic acid |
| SMILES | COc1ccc(F)c(-c2nocc2C(=O)Oc2cccc([C@@H](CC(=O)O)C3CC3)c2)c1 |
| InChI | InChI=1S/C23H20FNO6/c1-29-15-7-8-20(24)18(10-15)22-19(12-30-25-22)23(28)31-16-4-2-3-14(9-16)17(11-21(26)27)13-5-6-13/h2-4,7-10,12-13,17H,5-6,11H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | ZXYITRMNGADBTP-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|