C15H19FO2 — CID 117379319
3-cyclopropyl-3-(4-fluoro-3-propan-2-ylphenyl)propanoic acid (PubChem CID 117379319) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 3-cyclopropyl-3-(4-fluoro-3-propan-2-ylphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(4-fluoro-3-propan-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117379319 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-cyclopropyl-3-(4-fluoro-3-propan-2-ylphenyl)propanoic acid |
| SMILES | CC(C)c1cc(C(CC(=O)O)C2CC2)ccc1F |
| InChI | InChI=1S/C15H19FO2/c1-9(2)12-7-11(5-6-14(12)16)13(8-15(17)18)10-3-4-10/h5-7,9-10,13H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | UVVZYJXICGDSJQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |