C12H11BrF2O2 — CID 117490252
3-(4-bromo-3,5-difluorophenyl)-3-cyclopropylpropanoic acid (PubChem CID 117490252) has the molecular formula C12H11BrF2O2 and a molecular weight of 305.12 g/mol. Its IUPAC name is 3-(4-bromo-3,5-difluorophenyl)-3-cyclopropylpropanoic acid.
| Compound Name | 3-(4-bromo-3,5-difluorophenyl)-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 117490252 |
| Molecular Formula | C12H11BrF2O2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-(4-bromo-3,5-difluorophenyl)-3-cyclopropylpropanoic acid |
| SMILES | O=C(O)CC(c1cc(F)c(Br)c(F)c1)C1CC1 |
| InChI | InChI=1S/C12H11BrF2O2/c13-12-9(14)3-7(4-10(12)15)8(5-11(16)17)6-1-2-6/h3-4,6,8H,1-2,5H2,(H,16,17) |
| InChIKey | IUACRUHFBCGBAQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|