C25H24F6O — CID 97304173
(1R,5R)-1,5-di(cyclobutyl)-1,5-bis(3,4,5-trifluorophenyl)pentan-3-one (PubChem CID 97304173) has the molecular formula C25H24F6O and a molecular weight of 454.45 g/mol. Its IUPAC name is (1R,5R)-1,5-di(cyclobutyl)-1,5-bis(3,4,5-trifluorophenyl)pentan-3-one.
| Compound Name | (1R,5R)-1,5-di(cyclobutyl)-1,5-bis(3,4,5-trifluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 97304173 |
| Molecular Formula | C25H24F6O |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (1R,5R)-1,5-di(cyclobutyl)-1,5-bis(3,4,5-trifluorophenyl)pentan-3-one |
| SMILES | O=C(C[C@@H](c1cc(F)c(F)c(F)c1)C1CCC1)C[C@@H](c1cc(F)c(F)c(F)c1)C1CCC1 |
| InChI | InChI=1S/C25H24F6O/c26-20-7-15(8-21(27)24(20)30)18(13-3-1-4-13)11-17(32)12-19(14-5-2-6-14)16-9-22(28)25(31)23(29)10-16/h7-10,13-14,18-19H,1-6,11-12H2/t18-,19-/m1/s1 |
| InChIKey | CQNDYXHUYBCRND-RTBURBONSA-N |
| XLogP | 7.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|