C14H17F2NO — CID 82088149
3-cyclopentyl-3-(3,5-difluorophenyl)propanamide (PubChem CID 82088149) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 3-cyclopentyl-3-(3,5-difluorophenyl)propanamide.
| Compound Name | 3-cyclopentyl-3-(3,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 82088149 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-cyclopentyl-3-(3,5-difluorophenyl)propanamide |
| SMILES | NC(=O)CC(c1cc(F)cc(F)c1)C1CCCC1 |
| InChI | InChI=1S/C14H17F2NO/c15-11-5-10(6-12(16)7-11)13(8-14(17)18)9-3-1-2-4-9/h5-7,9,13H,1-4,8H2,(H2,17,18) |
| InChIKey | LWOHCPXDZFJNRZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |