C31H42O — CID 73011666
1,5-dicyclopentyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one (PubChem CID 73011666) has the molecular formula C31H42O and a molecular weight of 430.68 g/mol. Its IUPAC name is 1,5-dicyclopentyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one.
| Compound Name | 1,5-dicyclopentyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 73011666 |
| Molecular Formula | C31H42O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 1,5-dicyclopentyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one |
| SMILES | Cc1ccc(C(CC(=O)CC(c2ccc(C)c(C)c2)C2CCCC2)C2CCCC2)cc1C |
| InChI | InChI=1S/C31H42O/c1-21-13-15-27(17-23(21)3)30(25-9-5-6-10-25)19-29(32)20-31(26-11-7-8-12-26)28-16-14-22(2)24(4)18-28/h13-18,25-26,30-31H,5-12,19-20H2,1-4H3 |
| InChIKey | NFMCSMOKXMTRNO-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |