C33H46O — CID 97304221
(1R,5R)-1,5-dicyclohexyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one (PubChem CID 97304221) has the molecular formula C33H46O and a molecular weight of 458.73 g/mol. Its IUPAC name is (1R,5R)-1,5-dicyclohexyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one.
| Compound Name | (1R,5R)-1,5-dicyclohexyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 97304221 |
| Molecular Formula | C33H46O |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | (1R,5R)-1,5-dicyclohexyl-1,5-bis(3,4-dimethylphenyl)pentan-3-one |
| SMILES | Cc1ccc([C@H](CC(=O)C[C@@H](c2ccc(C)c(C)c2)C2CCCCC2)C2CCCCC2)cc1C |
| InChI | InChI=1S/C33H46O/c1-23-15-17-29(19-25(23)3)32(27-11-7-5-8-12-27)21-31(34)22-33(28-13-9-6-10-14-28)30-18-16-24(2)26(4)20-30/h15-20,27-28,32-33H,5-14,21-22H2,1-4H3/t32-,33-/m1/s1 |
| InChIKey | RXQKPEGKFPPICK-CZNDPXEESA-N |
| XLogP | 9.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |