C31H42O — CID 97304244
(1R,5S)-1,5-dicyclopentyl-1,5-bis(2,3-dimethylphenyl)pentan-3-one (PubChem CID 97304244) has the molecular formula C31H42O and a molecular weight of 430.68 g/mol. Its IUPAC name is (1R,5S)-1,5-dicyclopentyl-1,5-bis(2,3-dimethylphenyl)pentan-3-one.
| Compound Name | (1R,5S)-1,5-dicyclopentyl-1,5-bis(2,3-dimethylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 97304244 |
| Molecular Formula | C31H42O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | (1R,5S)-1,5-dicyclopentyl-1,5-bis(2,3-dimethylphenyl)pentan-3-one |
| SMILES | Cc1cccc([C@@H](CC(=O)C[C@@H](c2cccc(C)c2C)C2CCCC2)C2CCCC2)c1C |
| InChI | InChI=1S/C31H42O/c1-21-11-9-17-28(23(21)3)30(25-13-5-6-14-25)19-27(32)20-31(26-15-7-8-16-26)29-18-10-12-22(2)24(29)4/h9-12,17-18,25-26,30-31H,5-8,13-16,19-20H2,1-4H3/t30-,31+ |
| InChIKey | XUAUVEGARUUCFK-QRRGNZNSSA-N |
| XLogP | 8.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |