C29H38O — CID 97304157
(1S,5R)-1,5-di(cyclobutyl)-1,5-bis(2,4-dimethylphenyl)pentan-3-one (PubChem CID 97304157) has the molecular formula C29H38O and a molecular weight of 402.62 g/mol. Its IUPAC name is (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(2,4-dimethylphenyl)pentan-3-one.
| Compound Name | (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(2,4-dimethylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 97304157 |
| Molecular Formula | C29H38O |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(2,4-dimethylphenyl)pentan-3-one |
| SMILES | Cc1ccc([C@@H](CC(=O)C[C@@H](c2ccc(C)cc2C)C2CCC2)C2CCC2)c(C)c1 |
| InChI | InChI=1S/C29H38O/c1-19-11-13-26(21(3)15-19)28(23-7-5-8-23)17-25(30)18-29(24-9-6-10-24)27-14-12-20(2)16-22(27)4/h11-16,23-24,28-29H,5-10,17-18H2,1-4H3/t28-,29+ |
| InChIKey | MCLNRSGZVRSOPL-ISILISOKSA-N |
| XLogP | 7.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |