C27H34O3 — CID 97304184
(1S,5R)-1,5-di(cyclobutyl)-1,5-bis(3-methoxyphenyl)pentan-3-one (PubChem CID 97304184) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(3-methoxyphenyl)pentan-3-one.
| Compound Name | (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(3-methoxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 97304184 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (1S,5R)-1,5-di(cyclobutyl)-1,5-bis(3-methoxyphenyl)pentan-3-one |
| SMILES | COc1cccc([C@@H](CC(=O)C[C@@H](c2cccc(OC)c2)C2CCC2)C2CCC2)c1 |
| InChI | InChI=1S/C27H34O3/c1-29-24-13-5-11-21(15-24)26(19-7-3-8-19)17-23(28)18-27(20-9-4-10-20)22-12-6-14-25(16-22)30-2/h5-6,11-16,19-20,26-27H,3-4,7-10,17-18H2,1-2H3/t26-,27+ |
| InChIKey | VDMYBRQQFJWZKA-MKPDMIMOSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |