C15H17FO4 — CID 117449817
3-cyclopropyl-3-(3-fluoro-5-methoxycarbonyl-4-methylphenyl)propanoic acid (PubChem CID 117449817) has the molecular formula C15H17FO4 and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3-fluoro-5-methoxycarbonyl-4-methylphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(3-fluoro-5-methoxycarbonyl-4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117449817 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-cyclopropyl-3-(3-fluoro-5-methoxycarbonyl-4-methylphenyl)propanoic acid |
| SMILES | COC(=O)c1cc(C(CC(=O)O)C2CC2)cc(F)c1C |
| InChI | InChI=1S/C15H17FO4/c1-8-11(15(19)20-2)5-10(6-13(8)16)12(7-14(17)18)9-3-4-9/h5-6,9,12H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | BNVFWZSKQZSVAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |