C13H14F2O3 — CID 117393615
3-cyclopropyl-3-(2,6-difluoro-4-methoxyphenyl)propanoic acid (PubChem CID 117393615) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-cyclopropyl-3-(2,6-difluoro-4-methoxyphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(2,6-difluoro-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117393615 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-cyclopropyl-3-(2,6-difluoro-4-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(F)c(C(CC(=O)O)C2CC2)c(F)c1 |
| InChI | InChI=1S/C13H14F2O3/c1-18-8-4-10(14)13(11(15)5-8)9(6-12(16)17)7-2-3-7/h4-5,7,9H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | FUSKXVTYQDKJNL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |