C12H11ClF2O3 — CID 117443249
3-(3-chloro-2,5-difluoro-6-hydroxyphenyl)-3-cyclopropylpropanoic acid (PubChem CID 117443249) has the molecular formula C12H11ClF2O3 and a molecular weight of 276.67 g/mol. Its IUPAC name is 3-(3-chloro-2,5-difluoro-6-hydroxyphenyl)-3-cyclopropylpropanoic acid.
| Compound Name | 3-(3-chloro-2,5-difluoro-6-hydroxyphenyl)-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 117443249 |
| Molecular Formula | C12H11ClF2O3 |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-(3-chloro-2,5-difluoro-6-hydroxyphenyl)-3-cyclopropylpropanoic acid |
| SMILES | O=C(O)CC(c1c(O)c(F)cc(Cl)c1F)C1CC1 |
| InChI | InChI=1S/C12H11ClF2O3/c13-7-4-8(14)12(18)10(11(7)15)6(3-9(16)17)5-1-2-5/h4-6,18H,1-3H2,(H,16,17) |
| InChIKey | VPSATVUCJXWZTI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|