C13H11F3O4 — CID 117465468
4-(2-carboxy-1-cyclopropylethyl)-2,3,6-trifluorobenzoic acid (PubChem CID 117465468) has the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. Its IUPAC name is 4-(2-carboxy-1-cyclopropylethyl)-2,3,6-trifluorobenzoic acid.
| Compound Name | 4-(2-carboxy-1-cyclopropylethyl)-2,3,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 117465468 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(2-carboxy-1-cyclopropylethyl)-2,3,6-trifluorobenzoic acid |
| SMILES | O=C(O)CC(c1cc(F)c(C(=O)O)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C13H11F3O4/c14-8-3-7(6(4-9(17)18)5-1-2-5)11(15)12(16)10(8)13(19)20/h3,5-6H,1-2,4H2,(H,17,18)(H,19,20) |
| InChIKey | ZUFDRFOTCOYVTD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|