C12H12ClFO2 — CID 117358615
3-(2-chloro-6-fluorophenyl)-3-cyclopropylpropanoic acid (PubChem CID 117358615) has the molecular formula C12H12ClFO2 and a molecular weight of 242.68 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-3-cyclopropylpropanoic acid.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 117358615 |
| Molecular Formula | C12H12ClFO2 |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-3-cyclopropylpropanoic acid |
| SMILES | O=C(O)CC(c1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C12H12ClFO2/c13-9-2-1-3-10(14)12(9)8(6-11(15)16)7-4-5-7/h1-3,7-8H,4-6H2,(H,15,16) |
| InChIKey | VTWYRVRLAYSQHN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |