C14H18ClFO — CID 82089092
2-(2-chloro-6-fluorophenyl)-2-cyclohexylethanol (PubChem CID 82089092) has the molecular formula C14H18ClFO and a molecular weight of 256.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-2-cyclohexylethanol.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-2-cyclohexylethanol |
|---|---|
| PubChem CID | 82089092 |
| Molecular Formula | C14H18ClFO |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-2-cyclohexylethanol |
| SMILES | OCC(c1c(F)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H18ClFO/c15-12-7-4-8-13(16)14(12)11(9-17)10-5-2-1-3-6-10/h4,7-8,10-11,17H,1-3,5-6,9H2 |
| InChIKey | DCNYCHFJEZURCC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |