C13H18ClF2N — CID 171204110
(R)-cyclohexyl-(2,6-difluorophenyl)methanamine;hydrochloride (PubChem CID 171204110) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is (R)-cyclohexyl-(2,6-difluorophenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-(2,6-difluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171204110 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (R)-cyclohexyl-(2,6-difluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(F)cccc1F)C1CCCCC1 |
| InChI | InChI=1S/C13H17F2N.ClH/c14-10-7-4-8-11(15)12(10)13(16)9-5-2-1-3-6-9;/h4,7-9,13H,1-3,5-6,16H2;1H/t13-;/m1./s1 |
| InChIKey | XLMODBMSIZLYDE-BTQNPOSSSA-N |
| XLogP | 3.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |