C13H16ClF4N — CID 171231037
(S)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 171231037) has the molecular formula C13H16ClF4N and a molecular weight of 297.72 g/mol. Its IUPAC name is (S)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171231037 |
| Molecular Formula | C13H16ClF4N |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (S)-cyclopentyl-[3-fluoro-2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(F)c1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C13H15F4N.ClH/c14-10-7-3-6-9(11(10)13(15,16)17)12(18)8-4-1-2-5-8;/h3,6-8,12H,1-2,4-5,18H2;1H/t12-;/m0./s1 |
| InChIKey | OGLKHIKVIBDDHW-YDALLXLXSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |