C14H18ClF4N — CID 171229145
(S)-cyclohexyl-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 171229145) has the molecular formula C14H18ClF4N and a molecular weight of 311.75 g/mol. Its IUPAC name is (S)-cyclohexyl-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-cyclohexyl-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171229145 |
| Molecular Formula | C14H18ClF4N |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (S)-cyclohexyl-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(C(F)(F)F)ccc1F)C1CCCCC1 |
| InChI | InChI=1S/C14H17F4N.ClH/c15-12-7-6-10(14(16,17)18)8-11(12)13(19)9-4-2-1-3-5-9;/h6-9,13H,1-5,19H2;1H/t13-;/m0./s1 |
| InChIKey | MTNAACSNIMXTCZ-ZOWNYOTGSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |