C17H24F3N — CID 102754830
cyclooctyl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102754830) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is cyclooctyl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | cyclooctyl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102754830 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | cyclooctyl-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(N)C1CCCCCCC1 |
| InChI | InChI=1S/C17H24F3N/c1-12-11-14(17(18,19)20)9-10-15(12)16(21)13-7-5-3-2-4-6-8-13/h9-11,13,16H,2-8,21H2,1H3 |
| InChIKey | PPXBHUBVVPYALT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |