C14H15F6N — CID 171208851
(R)-[2,5-bis(trifluoromethyl)phenyl]-cyclopentylmethanamine (PubChem CID 171208851) has the molecular formula C14H15F6N and a molecular weight of 311.27 g/mol. Its IUPAC name is (R)-[2,5-bis(trifluoromethyl)phenyl]-cyclopentylmethanamine.
| Compound Name | (R)-[2,5-bis(trifluoromethyl)phenyl]-cyclopentylmethanamine |
|---|---|
| PubChem CID | 171208851 |
| Molecular Formula | C14H15F6N |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (R)-[2,5-bis(trifluoromethyl)phenyl]-cyclopentylmethanamine |
| SMILES | N[C@@H](c1cc(C(F)(F)F)ccc1C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C14H15F6N/c15-13(16,17)9-5-6-11(14(18,19)20)10(7-9)12(21)8-3-1-2-4-8/h5-8,12H,1-4,21H2/t12-/m1/s1 |
| InChIKey | GPEYDRDVIZONIS-GFCCVEGCSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |