C14H19ClF3N — CID 171206677
(R)-cyclohexyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 171206677) has the molecular formula C14H19ClF3N and a molecular weight of 293.76 g/mol. Its IUPAC name is (R)-cyclohexyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171206677 |
| Molecular Formula | C14H19ClF3N |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (R)-cyclohexyl-[2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccccc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C14H18F3N.ClH/c15-14(16,17)12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10;/h4-5,8-10,13H,1-3,6-7,18H2;1H/t13-;/m1./s1 |
| InChIKey | RTQHDQJHLZWSGY-BTQNPOSSSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |