C14H19ClF3NS — CID 171211805
(R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride (PubChem CID 171211805) has the molecular formula C14H19ClF3NS and a molecular weight of 325.83 g/mol. Its IUPAC name is (R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171211805 |
| Molecular Formula | C14H19ClF3NS |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccccc1SC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C14H18F3NS.ClH/c15-14(16,17)19-12-9-5-4-8-11(12)13(18)10-6-2-1-3-7-10;/h4-5,8-10,13H,1-3,6-7,18H2;1H/t13-;/m1./s1 |
| InChIKey | CUPPQWFWHHETLI-BTQNPOSSSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |