C14H19ClF3NOS — CID 171255592
2-[(S)-amino(cyclohexyl)methyl]-4-(trifluoromethylsulfanyl)phenol;hydrochloride (PubChem CID 171255592) has the molecular formula C14H19ClF3NOS and a molecular weight of 341.83 g/mol. Its IUPAC name is 2-[(S)-amino(cyclohexyl)methyl]-4-(trifluoromethylsulfanyl)phenol;hydrochloride.
| Compound Name | 2-[(S)-amino(cyclohexyl)methyl]-4-(trifluoromethylsulfanyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 171255592 |
| Molecular Formula | C14H19ClF3NOS |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-[(S)-amino(cyclohexyl)methyl]-4-(trifluoromethylsulfanyl)phenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(SC(F)(F)F)ccc1O)C1CCCCC1 |
| InChI | InChI=1S/C14H18F3NOS.ClH/c15-14(16,17)20-10-6-7-12(19)11(8-10)13(18)9-4-2-1-3-5-9;/h6-9,13,19H,1-5,18H2;1H/t13-;/m0./s1 |
| InChIKey | IHCFEBLRAWOYJI-ZOWNYOTGSA-N |
| XLogP | 5.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|