C10H12F3NOS — CID 171255563
2-[(1S)-1-aminopropyl]-4-(trifluoromethylsulfanyl)phenol (PubChem CID 171255563) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[(1S)-1-aminopropyl]-4-(trifluoromethylsulfanyl)phenol.
| Compound Name | 2-[(1S)-1-aminopropyl]-4-(trifluoromethylsulfanyl)phenol |
|---|---|
| PubChem CID | 171255563 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[(1S)-1-aminopropyl]-4-(trifluoromethylsulfanyl)phenol |
| SMILES | CC[C@H](N)c1cc(SC(F)(F)F)ccc1O |
| InChI | InChI=1S/C10H12F3NOS/c1-2-8(14)7-5-6(3-4-9(7)15)16-10(11,12)13/h3-5,8,15H,2,14H2,1H3/t8-/m0/s1 |
| InChIKey | BWYKHAARTOPUER-QMMMGPOBSA-N |
| XLogP | 3.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|