C9H12FNO2 — CID 130062351
4-(1-aminopropyl)-2-fluorobenzene-1,3-diol (PubChem CID 130062351) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-(1-aminopropyl)-2-fluorobenzene-1,3-diol.
| Compound Name | 4-(1-aminopropyl)-2-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 130062351 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-(1-aminopropyl)-2-fluorobenzene-1,3-diol |
| SMILES | CCC(N)c1ccc(O)c(F)c1O |
| InChI | InChI=1S/C9H12FNO2/c1-2-6(11)5-3-4-7(12)8(10)9(5)13/h3-4,6,12-13H,2,11H2,1H3 |
| InChIKey | WILCGBSOCKGZJN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|