C10H13F2NO — CID 130690034
4-[(1R)-1-amino-2-methylpropyl]-2,3-difluorophenol (PubChem CID 130690034) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2-methylpropyl]-2,3-difluorophenol.
| Compound Name | 4-[(1R)-1-amino-2-methylpropyl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 130690034 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-[(1R)-1-amino-2-methylpropyl]-2,3-difluorophenol |
| SMILES | CC(C)[C@@H](N)c1ccc(O)c(F)c1F |
| InChI | InChI=1S/C10H13F2NO/c1-5(2)10(13)6-3-4-7(14)9(12)8(6)11/h3-5,10,14H,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | VKMMJGFBHJBNSB-SNVBAGLBSA-N |
| XLogP | 2.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |