C9H12FNO3 — CID 84776108
4-(2-amino-1-hydroxypropyl)-2-fluorobenzene-1,3-diol (PubChem CID 84776108) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxypropyl)-2-fluorobenzene-1,3-diol.
| Compound Name | 4-(2-amino-1-hydroxypropyl)-2-fluorobenzene-1,3-diol |
|---|---|
| PubChem CID | 84776108 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 4-(2-amino-1-hydroxypropyl)-2-fluorobenzene-1,3-diol |
| SMILES | CC(N)C(O)c1ccc(O)c(F)c1O |
| InChI | InChI=1S/C9H12FNO3/c1-4(11)8(13)5-2-3-6(12)7(10)9(5)14/h2-4,8,12-14H,11H2,1H3 |
| InChIKey | YWSXCRKZIMCOLO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |