C9H10BrF2NO — CID 164658455
2-amino-1-(4-bromo-2,3-difluorophenyl)propan-1-ol (PubChem CID 164658455) has the molecular formula C9H10BrF2NO and a molecular weight of 266.09 g/mol. Its IUPAC name is 2-amino-1-(4-bromo-2,3-difluorophenyl)propan-1-ol.
| Compound Name | 2-amino-1-(4-bromo-2,3-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 164658455 |
| Molecular Formula | C9H10BrF2NO |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-amino-1-(4-bromo-2,3-difluorophenyl)propan-1-ol |
| SMILES | CC(N)C(O)c1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C9H10BrF2NO/c1-4(13)9(14)5-2-3-6(10)8(12)7(5)11/h2-4,9,14H,13H2,1H3 |
| InChIKey | NZHUDJDPMBLFSG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|