C8H10ClF2NO — CID 171253098
6-[(1S)-1-aminoethyl]-2,3-difluorophenol;hydrochloride (PubChem CID 171253098) has the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. Its IUPAC name is 6-[(1S)-1-aminoethyl]-2,3-difluorophenol;hydrochloride.
| Compound Name | 6-[(1S)-1-aminoethyl]-2,3-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171253098 |
| Molecular Formula | C8H10ClF2NO |
| Molecular Weight | 209.62 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 6-[(1S)-1-aminoethyl]-2,3-difluorophenol;hydrochloride |
| SMILES | C[C@H](N)c1ccc(F)c(F)c1O.Cl |
| InChI | InChI=1S/C8H9F2NO.ClH/c1-4(11)5-2-3-6(9)7(10)8(5)12;/h2-4,12H,11H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | DWXSTLBBFMOHQC-WCCKRBBISA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|