C9H10ClF2NO — CID 171253100
6-[(1S)-1-aminoprop-2-enyl]-2,3-difluorophenol;hydrochloride (PubChem CID 171253100) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is 6-[(1S)-1-aminoprop-2-enyl]-2,3-difluorophenol;hydrochloride.
| Compound Name | 6-[(1S)-1-aminoprop-2-enyl]-2,3-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171253100 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 6-[(1S)-1-aminoprop-2-enyl]-2,3-difluorophenol;hydrochloride |
| SMILES | C=C[C@H](N)c1ccc(F)c(F)c1O.Cl |
| InChI | InChI=1S/C9H9F2NO.ClH/c1-2-7(12)5-3-4-6(10)8(11)9(5)13;/h2-4,7,13H,1,12H2;1H/t7-;/m0./s1 |
| InChIKey | VYHZKHZXFAUUBQ-FJXQXJEOSA-N |
| XLogP | 2.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|