C9H11NO2 — CID 130642432
3-[(1S)-1-aminoprop-2-enyl]benzene-1,2-diol (PubChem CID 130642432) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-[(1S)-1-aminoprop-2-enyl]benzene-1,2-diol.
| Compound Name | 3-[(1S)-1-aminoprop-2-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 130642432 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-[(1S)-1-aminoprop-2-enyl]benzene-1,2-diol |
| SMILES | C=C[C@H](N)c1cccc(O)c1O |
| InChI | InChI=1S/C9H11NO2/c1-2-7(10)6-4-3-5-8(11)9(6)12/h2-5,7,11-12H,1,10H2/t7-/m0/s1 |
| InChIKey | AWCQVNZHPGGUSO-ZETCQYMHSA-N |
| XLogP | 1.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|