C9H10ClF2N — CID 171204130
(1R)-1-(2,3-difluorophenyl)prop-2-en-1-amine;hydrochloride (PubChem CID 171204130) has the molecular formula C9H10ClF2N and a molecular weight of 205.64 g/mol. Its IUPAC name is (1R)-1-(2,3-difluorophenyl)prop-2-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,3-difluorophenyl)prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204130 |
| Molecular Formula | C9H10ClF2N |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (1R)-1-(2,3-difluorophenyl)prop-2-en-1-amine;hydrochloride |
| SMILES | C=C[C@@H](N)c1cccc(F)c1F.Cl |
| InChI | InChI=1S/C9H9F2N.ClH/c1-2-8(12)6-4-3-5-7(10)9(6)11;/h2-5,8H,1,12H2;1H/t8-;/m1./s1 |
| InChIKey | DODTYMKFGRXMAG-DDWIOCJRSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|