C8H8F3N — CID 130740137
(1R)-1-(2,3-difluorophenyl)-2-fluoroethanamine (PubChem CID 130740137) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is (1R)-1-(2,3-difluorophenyl)-2-fluoroethanamine.
| Compound Name | (1R)-1-(2,3-difluorophenyl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 130740137 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (1R)-1-(2,3-difluorophenyl)-2-fluoroethanamine |
| SMILES | N[C@@H](CF)c1cccc(F)c1F |
| InChI | InChI=1S/C8H8F3N/c9-4-7(12)5-2-1-3-6(10)8(5)11/h1-3,7H,4,12H2/t7-/m0/s1 |
| InChIKey | HDHHVHOYKUJSIK-ZETCQYMHSA-N |
| XLogP | 1.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |