C14H21F2N — CID 115861931
1-(2,3-difluorophenyl)-3,4,4-trimethylpentan-1-amine (PubChem CID 115861931) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3,4,4-trimethylpentan-1-amine.
| Compound Name | 1-(2,3-difluorophenyl)-3,4,4-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 115861931 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3,4,4-trimethylpentan-1-amine |
| SMILES | CC(CC(N)c1cccc(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C14H21F2N/c1-9(14(2,3)4)8-12(17)10-6-5-7-11(15)13(10)16/h5-7,9,12H,8,17H2,1-4H3 |
| InChIKey | QFPGWIKPSPQDIU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |