C11H13F2N — CID 131113466
(1S)-2-cyclopropyl-1-(2,3-difluorophenyl)ethanamine (PubChem CID 131113466) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-(2,3-difluorophenyl)ethanamine.
| Compound Name | (1S)-2-cyclopropyl-1-(2,3-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 131113466 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (1S)-2-cyclopropyl-1-(2,3-difluorophenyl)ethanamine |
| SMILES | N[C@@H](CC1CC1)c1cccc(F)c1F |
| InChI | InChI=1S/C11H13F2N/c12-9-3-1-2-8(11(9)13)10(14)6-7-4-5-7/h1-3,7,10H,4-6,14H2/t10-/m0/s1 |
| InChIKey | SMHXRWFYGNTRPH-JTQLQIEISA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |