C13H18F2N2 — CID 105299116
[2-cyclopentyl-1-(2,3-difluorophenyl)ethyl]hydrazine (PubChem CID 105299116) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is [2-cyclopentyl-1-(2,3-difluorophenyl)ethyl]hydrazine.
| Compound Name | [2-cyclopentyl-1-(2,3-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105299116 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [2-cyclopentyl-1-(2,3-difluorophenyl)ethyl]hydrazine |
| SMILES | NNC(CC1CCCC1)c1cccc(F)c1F |
| InChI | InChI=1S/C13H18F2N2/c14-11-7-3-6-10(13(11)15)12(17-16)8-9-4-1-2-5-9/h3,6-7,9,12,17H,1-2,4-5,8,16H2 |
| InChIKey | SZRHZTPXNSJPGR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|