C11H13BrF2N2 — CID 107541167
[1-(2-bromo-3,4-difluorophenyl)-2-cyclopropylethyl]hydrazine (PubChem CID 107541167) has the molecular formula C11H13BrF2N2 and a molecular weight of 291.14 g/mol. Its IUPAC name is [1-(2-bromo-3,4-difluorophenyl)-2-cyclopropylethyl]hydrazine.
| Compound Name | [1-(2-bromo-3,4-difluorophenyl)-2-cyclopropylethyl]hydrazine |
|---|---|
| PubChem CID | 107541167 |
| Molecular Formula | C11H13BrF2N2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | [1-(2-bromo-3,4-difluorophenyl)-2-cyclopropylethyl]hydrazine |
| SMILES | NNC(CC1CC1)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C11H13BrF2N2/c12-10-7(3-4-8(13)11(10)14)9(16-15)5-6-1-2-6/h3-4,6,9,16H,1-2,5,15H2 |
| InChIKey | SIJXPWOSQUDEGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|