C8H10FNO2 — CID 131172415
3-[(1R)-1-amino-2-fluoroethyl]benzene-1,2-diol (PubChem CID 131172415) has the molecular formula C8H10FNO2 and a molecular weight of 171.17 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2-fluoroethyl]benzene-1,2-diol.
| Compound Name | 3-[(1R)-1-amino-2-fluoroethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 131172415 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-[(1R)-1-amino-2-fluoroethyl]benzene-1,2-diol |
| SMILES | N[C@@H](CF)c1cccc(O)c1O |
| InChI | InChI=1S/C8H10FNO2/c9-4-6(10)5-2-1-3-7(11)8(5)12/h1-3,6,11-12H,4,10H2/t6-/m0/s1 |
| InChIKey | PCZQQTLGAXKNOJ-LURJTMIESA-N |
| XLogP | 1.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|