C9H10BrF2NO — CID 131326397
2-[(1R)-1-amino-3,3-difluoropropyl]-6-bromophenol (PubChem CID 131326397) has the molecular formula C9H10BrF2NO and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3,3-difluoropropyl]-6-bromophenol.
| Compound Name | 2-[(1R)-1-amino-3,3-difluoropropyl]-6-bromophenol |
|---|---|
| PubChem CID | 131326397 |
| Molecular Formula | C9H10BrF2NO |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-[(1R)-1-amino-3,3-difluoropropyl]-6-bromophenol |
| SMILES | N[C@H](CC(F)F)c1cccc(Br)c1O |
| InChI | InChI=1S/C9H10BrF2NO/c10-6-3-1-2-5(9(6)14)7(13)4-8(11)12/h1-3,7-8,14H,4,13H2/t7-/m1/s1 |
| InChIKey | DKCJPLFVHHLAHD-SSDOTTSWSA-N |
| XLogP | 2.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|